C24H39N3O2 — CID 110194822
4-[(5R,6R,9S,13S)-7-(cyclobutanecarbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide (PubChem CID 110194822) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-(cyclobutanecarbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-(cyclobutanecarbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide |
|---|---|
| PubChem CID | 110194822 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-(cyclobutanecarbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)C1CCC1)[C@@H]23)NCC1CC1 |
| InChI | InChI=1S/C24H39N3O2/c28-22(25-15-17-11-12-17)10-2-9-21-20-8-4-14-26-13-3-7-19(23(20)26)16-27(21)24(29)18-5-1-6-18/h17-21,23H,1-16H2,(H,25,28)/t19-,20+,21+,23-/m0/s1 |
| InChIKey | DTNYKRANCCFKEV-GNXKAVGDSA-N |
| XLogP | 3.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |