C23H39N3O3 — CID 110194832
N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(2-ethoxyacetyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110194832) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(2-ethoxyacetyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(2-ethoxyacetyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110194832 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(2-ethoxyacetyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | CCOCC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCC1CC1 |
| InChI | InChI=1S/C23H39N3O3/c1-2-29-16-22(28)26-15-18-6-4-12-25-13-5-7-19(23(18)25)20(26)8-3-9-21(27)24-14-17-10-11-17/h17-20,23H,2-16H2,1H3,(H,24,27)/t18-,19+,20+,23-/m0/s1 |
| InChIKey | RIUKOVMPXLAZRE-VAWZGJIGSA-N |
| XLogP | 2.42 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |