C23H40N4O2 — CID 110194845
(5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-propyl-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide (PubChem CID 110194845) has the molecular formula C23H40N4O2 and a molecular weight of 404.60 g/mol. Its IUPAC name is (5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-propyl-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide.
| Compound Name | (5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-propyl-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
|---|---|
| PubChem CID | 110194845 |
| Molecular Formula | C23H40N4O2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | (5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-propyl-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
| SMILES | CCCNC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCC1CC1 |
| InChI | InChI=1S/C23H40N4O2/c1-2-12-24-23(29)27-16-18-6-4-13-26-14-5-7-19(22(18)26)20(27)8-3-9-21(28)25-15-17-10-11-17/h17-20,22H,2-16H2,1H3,(H,24,29)(H,25,28)/t18-,19+,20+,22-/m0/s1 |
| InChIKey | VNVJREGLYYTBNO-HIUFNZKISA-N |
| XLogP | 2.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |