C23H39N3O2 — CID 110194848
4-[(5R,6R,9S,13S)-7-butanoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide (PubChem CID 110194848) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-butanoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-butanoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide |
|---|---|
| PubChem CID | 110194848 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-butanoyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(cyclopropylmethyl)butanamide |
| SMILES | CCCC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCC1CC1 |
| InChI | InChI=1S/C23H39N3O2/c1-2-6-22(28)26-16-18-7-4-13-25-14-5-8-19(23(18)25)20(26)9-3-10-21(27)24-15-17-11-12-17/h17-20,23H,2-16H2,1H3,(H,24,27)/t18-,19+,20+,23-/m0/s1 |
| InChIKey | OBFFDLDKYQVOCR-VAWZGJIGSA-N |
| XLogP | 3.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |