C20H35N3O — CID 110194891
N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110194891) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110194891 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | CN1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCC1CC1 |
| InChI | InChI=1S/C20H35N3O/c1-22-14-16-5-3-11-23-12-4-6-17(20(16)23)18(22)7-2-8-19(24)21-13-15-9-10-15/h15-18,20H,2-14H2,1H3,(H,21,24)/t16-,17+,18+,20-/m0/s1 |
| InChIKey | PSUFSAWMIXMSHC-XFKSJGNHSA-N |
| XLogP | 2.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |