C22H38N4O2 — CID 110195143
N-[3-(azepan-1-yl)propyl]-2-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide (PubChem CID 110195143) has the molecular formula C22H38N4O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-2-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-2-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide |
|---|---|
| PubChem CID | 110195143 |
| Molecular Formula | C22H38N4O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-2-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide |
| SMILES | O=C(CN1C[C@H]2C[C@H](C1)[C@H]1CCCC(=O)N1C2)NCCCN1CCCCCC1 |
| InChI | InChI=1S/C22H38N4O2/c27-21(23-9-6-12-24-10-3-1-2-4-11-24)17-25-14-18-13-19(16-25)20-7-5-8-22(28)26(20)15-18/h18-20H,1-17H2,(H,23,27)/t18-,19-,20-/m1/s1 |
| InChIKey | NKFNVXPBIXTCPU-VAMGGRTRSA-N |
| XLogP | 1.70 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|