C25H28N4O4 — CID 110195417
N-(1,3-benzodioxol-5-ylmethyl)-6-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide (PubChem CID 110195417) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110195417 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[(1R,2R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc(N2C[C@H]3C[C@H](C2)[C@H]2CCCC(=O)N2C3)nc1 |
| InChI | InChI=1S/C25H28N4O4/c30-24-3-1-2-20-19-8-17(13-29(20)24)12-28(14-19)23-7-5-18(11-26-23)25(31)27-10-16-4-6-21-22(9-16)33-15-32-21/h4-7,9,11,17,19-20H,1-3,8,10,12-15H2,(H,27,31)/t17-,19-,20-/m1/s1 |
| InChIKey | AHQVEZPCTTZUOG-MISYRCLQSA-N |
| XLogP | 2.58 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |