C25H34N4O4S — CID 110195683
(1R,2R,9S)-11-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 110195683) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is (1R,2R,9S)-11-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2R,9S)-11-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 110195683 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (1R,2R,9S)-11-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C(N1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1)N1C[C@H]2C[C@H](C1)[C@H]1CCCC(=O)N1C2 |
| InChI | InChI=1S/C25H34N4O4S/c30-24-6-2-5-23-21-13-18(16-29(23)24)15-27(17-21)25(31)26-9-11-28(12-10-26)34(32,33)22-8-7-19-3-1-4-20(19)14-22/h7-8,14,18,21,23H,1-6,9-13,15-17H2/t18-,21-,23-/m1/s1 |
| InChIKey | VWYIXEQLZRRWHE-JMUQELJHSA-N |
| XLogP | 1.93 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |