C22H40N4O — CID 110195718
4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methyl-1,4-diazepan-1-yl)butan-1-one (PubChem CID 110195718) has the molecular formula C22H40N4O and a molecular weight of 376.59 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methyl-1,4-diazepan-1-yl)butan-1-one.
| Compound Name | 4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methyl-1,4-diazepan-1-yl)butan-1-one |
|---|---|
| PubChem CID | 110195718 |
| Molecular Formula | C22H40N4O |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-1-(4-methyl-1,4-diazepan-1-yl)butan-1-one |
| SMILES | CN1CCCN(C(=O)CCC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C)[C@@H]34)CC1 |
| InChI | InChI=1S/C22H40N4O/c1-23-11-6-14-25(16-15-23)21(27)10-3-9-20-19-8-5-13-26-12-4-7-18(22(19)26)17-24(20)2/h18-20,22H,3-17H2,1-2H3/t18-,19+,20+,22-/m0/s1 |
| InChIKey | COIFZLBDPCCOMI-HIUFNZKISA-N |
| XLogP | 2.13 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |