C25H37N5O — CID 110195742
N-[2-(1H-benzimidazol-2-yl)ethyl]-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110195742) has the molecular formula C25H37N5O and a molecular weight of 423.61 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110195742 |
| Molecular Formula | C25H37N5O |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-4-[(5R,6R,9S,13S)-7-methyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | CN1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H37N5O/c1-29-17-18-7-5-15-30-16-6-8-19(25(18)30)22(29)11-4-12-24(31)26-14-13-23-27-20-9-2-3-10-21(20)28-23/h2-3,9-10,18-19,22,25H,4-8,11-17H2,1H3,(H,26,31)(H,27,28)/t18-,19+,22+,25-/m0/s1 |
| InChIKey | LASULZPXPWLLEC-BBVKZKKFSA-N |
| XLogP | 3.20 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |