C19H33N3O2 — CID 110195788
4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N,N-dimethylbutanamide (PubChem CID 110195788) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N,N-dimethylbutanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 110195788 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N,N-dimethylbutanamide |
| SMILES | CC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)N(C)C |
| InChI | InChI=1S/C19H33N3O2/c1-14(23)22-13-15-7-5-11-21-12-6-8-16(19(15)21)17(22)9-4-10-18(24)20(2)3/h15-17,19H,4-13H2,1-3H3/t15-,16+,17+,19-/m0/s1 |
| InChIKey | QHEVJIWQLAQFIR-FAJBIJEISA-N |
| XLogP | 1.97 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |