C19H33N3O2 — CID 110195794
4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-ethylbutanamide (PubChem CID 110195794) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-ethylbutanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-ethylbutanamide |
|---|---|
| PubChem CID | 110195794 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-ethylbutanamide |
| SMILES | CCNC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(C)=O)[C@@H]23 |
| InChI | InChI=1S/C19H33N3O2/c1-3-20-18(24)10-4-9-17-16-8-6-12-21-11-5-7-15(19(16)21)13-22(17)14(2)23/h15-17,19H,3-13H2,1-2H3,(H,20,24)/t15-,16+,17+,19-/m0/s1 |
| InChIKey | OALDTELBRTVLMP-FAJBIJEISA-N |
| XLogP | 2.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |