C24H42N4O2 — CID 110195814
4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(2-piperidin-1-ylethyl)butanamide (PubChem CID 110195814) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(2-piperidin-1-ylethyl)butanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(2-piperidin-1-ylethyl)butanamide |
|---|---|
| PubChem CID | 110195814 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(2-piperidin-1-ylethyl)butanamide |
| SMILES | CC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCCN1CCCCC1 |
| InChI | InChI=1S/C24H42N4O2/c1-19(29)28-18-20-8-6-15-27-16-7-9-21(24(20)27)22(28)10-5-11-23(30)25-12-17-26-13-3-2-4-14-26/h20-22,24H,2-18H2,1H3,(H,25,30)/t20-,21+,22+,24-/m0/s1 |
| InChIKey | MZYOPVSMTCZTEA-NXYDZRKXSA-N |
| XLogP | 2.48 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |