C25H45N5O2 — CID 110195859
4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]butanamide (PubChem CID 110195859) has the molecular formula C25H45N5O2 and a molecular weight of 447.67 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]butanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 110195859 |
| Molecular Formula | C25H45N5O2 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.36 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]butanamide |
| SMILES | CCN1CCN(CCNC(=O)CCC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C(C)=O)[C@@H]34)CC1 |
| InChI | InChI=1S/C25H45N5O2/c1-3-27-15-17-28(18-16-27)14-11-26-24(32)10-4-9-23-22-8-6-13-29-12-5-7-21(25(22)29)19-30(23)20(2)31/h21-23,25H,3-19H2,1-2H3,(H,26,32)/t21-,22+,23+,25-/m0/s1 |
| InChIKey | NJCARTOPMWUFCM-KBOSCXGNSA-N |
| XLogP | 1.63 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |