C28H43N5O2 — CID 110195957
N-(2-piperidin-1-ylethyl)-4-[(5R,6R,9S,13S)-7-(pyridine-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110195957) has the molecular formula C28H43N5O2 and a molecular weight of 481.69 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-4-[(5R,6R,9S,13S)-7-(pyridine-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-(2-piperidin-1-ylethyl)-4-[(5R,6R,9S,13S)-7-(pyridine-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110195957 |
| Molecular Formula | C28H43N5O2 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-4-[(5R,6R,9S,13S)-7-(pyridine-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)c1cccnc1)[C@@H]23)NCCN1CCCCC1 |
| InChI | InChI=1S/C28H43N5O2/c34-26(30-14-19-31-15-2-1-3-16-31)12-4-11-25-24-10-7-18-32-17-6-9-23(27(24)32)21-33(25)28(35)22-8-5-13-29-20-22/h5,8,13,20,23-25,27H,1-4,6-7,9-12,14-19,21H2,(H,30,34)/t23-,24+,25+,27-/m0/s1 |
| InChIKey | SCNKJPATFIUWOH-FCRYVSRXSA-N |
| XLogP | 3.17 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |