About N-benzylcyclohexanimine
N-benzylcyclohexanimine (PubChem CID 11019604) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is N-benzylcyclohexanimine.
Molecular Properties
| Compound Name | N-benzylcyclohexanimine |
| PubChem CID | 11019604 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-benzylcyclohexanimine |
| SMILES | c1ccc(CN=C2CCCCC2)cc1 |
| InChI | InChI=1S/C13H17N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1,3-4,7-8H,2,5-6,9-11H2 |
| InChIKey | CYTHNXXBHKXYMA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzylcyclohexanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylcyclohexanimine?
The IUPAC name of N-benzylcyclohexanimine (CID 11019604) is N-benzylcyclohexanimine.
What is the SMILES notation for N-benzylcyclohexanimine?
The canonical SMILES for N-benzylcyclohexanimine is c1ccc(CN=C2CCCCC2)cc1.
What is the InChIKey of N-benzylcyclohexanimine?
The InChIKey is CYTHNXXBHKXYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1,3-4,7-8H,2,5-6,9-11H2.
What are the key properties of N-benzylcyclohexanimine?
N-benzylcyclohexanimine has a molecular weight of 187.29 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylcyclohexanimine is sourced from PubChem (CID 11019604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).