C14H20N2O2S — CID 110196084
[(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-thiophen-3-ylmethanone (PubChem CID 110196084) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is [(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-thiophen-3-ylmethanone.
| Compound Name | [(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 110196084 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-thiophen-3-ylmethanone |
| SMILES | CN1CCOC[C@H]2CCN(C(=O)c3ccsc3)C[C@H]21 |
| InChI | InChI=1S/C14H20N2O2S/c1-15-5-6-18-9-11-2-4-16(8-13(11)15)14(17)12-3-7-19-10-12/h3,7,10-11,13H,2,4-6,8-9H2,1H3/t11-,13-/m1/s1 |
| InChIKey | YBNRCICJSNVSRN-DGCLKSJQSA-N |
| XLogP | 1.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |