C14H26N2O2 — CID 110196088
1-[(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-3-methylbutan-1-one (PubChem CID 110196088) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-[(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 110196088 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-[(5aS,9aS)-1-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CC[C@@H]2COCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C14H26N2O2/c1-11(2)8-14(17)16-5-4-12-10-18-7-6-15(3)13(12)9-16/h11-13H,4-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | NFNMMANMFMGSCE-CHWSQXEVSA-N |
| XLogP | 1.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |