C16H28N2O3 — CID 110196093
[(5aS,9aS)-1-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-cyclobutylmethanone (PubChem CID 110196093) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(5aS,9aS)-1-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-cyclobutylmethanone.
| Compound Name | [(5aS,9aS)-1-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 110196093 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | [(5aS,9aS)-1-(2-methoxyethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[3,4-e][1,4]oxazepin-8-yl]-cyclobutylmethanone |
| SMILES | COCCN1CCOC[C@H]2CCN(C(=O)C3CCC3)C[C@H]21 |
| InChI | InChI=1S/C16H28N2O3/c1-20-9-7-17-8-10-21-12-14-5-6-18(11-15(14)17)16(19)13-3-2-4-13/h13-15H,2-12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | MSHSGDYICLQXOQ-HUUCEWRRSA-N |
| XLogP | 0.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |