About [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone
[3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone (PubChem CID 110196098) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone |
| PubChem CID | 110196098 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(Cc2noc(C3CC3)n2)C1 |
| InChI | InChI=1S/C17H19N3O2/c21-17(14-4-2-1-3-5-14)20-9-8-12(11-20)10-15-18-16(22-19-15)13-6-7-13/h1-5,12-13H,6-11H2 |
| InChIKey | ZKFXKWTYVCQURN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone?
The IUPAC name of [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone (CID 110196098) is [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone.
What is the SMILES notation for [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone?
The canonical SMILES for [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone is O=C(c1ccccc1)N1CCC(Cc2noc(C3CC3)n2)C1.
What is the InChIKey of [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone?
The InChIKey is ZKFXKWTYVCQURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c21-17(14-4-2-1-3-5-14)20-9-8-12(11-20)10-15-18-16(22-19-15)13-6-7-13/h1-5,12-13H,6-11H2.
What are the key properties of [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone?
[3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone has a molecular weight of 297.36 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-yl]-phenylmethanone is sourced from PubChem (CID 110196098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).