C14H24N2O2 — CID 110196329
N-(cyclohexylmethyl)-7-oxoazepane-2-carboxamide (PubChem CID 110196329) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-7-oxoazepane-2-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-7-oxoazepane-2-carboxamide |
|---|---|
| PubChem CID | 110196329 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-(cyclohexylmethyl)-7-oxoazepane-2-carboxamide |
| SMILES | O=C1CCCCC(C(=O)NCC2CCCCC2)N1 |
| InChI | InChI=1S/C14H24N2O2/c17-13-9-5-4-8-12(16-13)14(18)15-10-11-6-2-1-3-7-11/h11-12H,1-10H2,(H,15,18)(H,16,17) |
| InChIKey | DUJPVLWGOLXLGS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |