About 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one
2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one (PubChem CID 110196358) has the molecular formula C15H20N4O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one.
Molecular Properties
| Compound Name | 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one |
| PubChem CID | 110196358 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one |
| SMILES | Cc1ncc2c(n1)CCCN(CC(=O)N1CCCC1)C2=O |
| InChI | InChI=1S/C15H20N4O2/c1-11-16-9-12-13(17-11)5-4-8-19(15(12)21)10-14(20)18-6-2-3-7-18/h9H,2-8,10H2,1H3 |
| InChIKey | DOEBVQRVAQJVGC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one?
The IUPAC name of 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one (CID 110196358) is 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one.
What is the SMILES notation for 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one?
The canonical SMILES for 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one is Cc1ncc2c(n1)CCCN(CC(=O)N1CCCC1)C2=O.
What is the InChIKey of 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one?
The InChIKey is DOEBVQRVAQJVGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2/c1-11-16-9-12-13(17-11)5-4-8-19(15(12)21)10-14(20)18-6-2-3-7-18/h9H,2-8,10H2,1H3.
What are the key properties of 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one?
2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one has a molecular weight of 288.35 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(2-oxo-2-pyrrolidin-1-ylethyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-5-one is sourced from PubChem (CID 110196358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).