About 2-(furan-2-ylmethyl)benzene-1,4-diol
2-(furan-2-ylmethyl)benzene-1,4-diol (PubChem CID 11019639) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-(furan-2-ylmethyl)benzene-1,4-diol |
| PubChem CID | 11019639 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-(furan-2-ylmethyl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(Cc2ccco2)c1 |
| InChI | InChI=1S/C11H10O3/c12-9-3-4-11(13)8(6-9)7-10-2-1-5-14-10/h1-6,12-13H,7H2 |
| InChIKey | XILYZMFMZQXKMC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-ylmethyl)benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-ylmethyl)benzene-1,4-diol?
The IUPAC name of 2-(furan-2-ylmethyl)benzene-1,4-diol (CID 11019639) is 2-(furan-2-ylmethyl)benzene-1,4-diol.
What is the SMILES notation for 2-(furan-2-ylmethyl)benzene-1,4-diol?
The canonical SMILES for 2-(furan-2-ylmethyl)benzene-1,4-diol is Oc1ccc(O)c(Cc2ccco2)c1.
What is the InChIKey of 2-(furan-2-ylmethyl)benzene-1,4-diol?
The InChIKey is XILYZMFMZQXKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c12-9-3-4-11(13)8(6-9)7-10-2-1-5-14-10/h1-6,12-13H,7H2.
What are the key properties of 2-(furan-2-ylmethyl)benzene-1,4-diol?
2-(furan-2-ylmethyl)benzene-1,4-diol has a molecular weight of 190.20 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-ylmethyl)benzene-1,4-diol is sourced from PubChem (CID 11019639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).