C16H16N4O3S — CID 110196590
methyl 3-[[(1R,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 110196590) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is methyl 3-[[(1R,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(1R,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 110196590 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl 3-[[(1R,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)N1[C@H]2CC[C@@H]1c1cncnc1C2 |
| InChI | InChI=1S/C16H16N4O3S/c1-23-15(21)14-11(4-5-24-14)19-16(22)20-9-2-3-13(20)10-7-17-8-18-12(10)6-9/h4-5,7-9,13H,2-3,6H2,1H3,(H,19,22)/t9-,13+/m0/s1 |
| InChIKey | ABLUDCHKAFFWRV-TVQRCGJNSA-N |
| XLogP | 2.62 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |