C18H18FN3O2 — CID 110196614
(3-fluoro-4-methoxyphenyl)-[(1R,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 110196614) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-[(1R,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-[(1R,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 110196614 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-[(1R,9S)-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | COc1ccc(C(=O)N2[C@H]3CC[C@@H]2c2cnc(C)nc2C3)cc1F |
| InChI | InChI=1S/C18H18FN3O2/c1-10-20-9-13-15(21-10)8-12-4-5-16(13)22(12)18(23)11-3-6-17(24-2)14(19)7-11/h3,6-7,9,12,16H,4-5,8H2,1-2H3/t12-,16+/m0/s1 |
| InChIKey | RVPREVIMBYXTLE-BLLLJJGKSA-N |
| XLogP | 2.83 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |