C20H24N4O — CID 110196669
(1R,9S)-N-tert-butyl-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 110196669) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (1R,9S)-N-tert-butyl-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9S)-N-tert-butyl-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 110196669 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (1R,9S)-N-tert-butyl-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1[C@H]2CC[C@@H]1c1cnc(-c3ccccc3)nc1C2 |
| InChI | InChI=1S/C20H24N4O/c1-20(2,3)23-19(25)24-14-9-10-17(24)15-12-21-18(22-16(15)11-14)13-7-5-4-6-8-13/h4-8,12,14,17H,9-11H2,1-3H3,(H,23,25)/t14-,17+/m0/s1 |
| InChIKey | JNFOUDAZPZVLAZ-WMLDXEAASA-N |
| XLogP | 3.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |