C21H19N3OS — CID 110196679
(3-methylthiophen-2-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 110196679) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (3-methylthiophen-2-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | (3-methylthiophen-2-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 110196679 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (3-methylthiophen-2-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | Cc1ccsc1C(=O)N1[C@H]2CC[C@@H]1c1cnc(-c3ccccc3)nc1C2 |
| InChI | InChI=1S/C21H19N3OS/c1-13-9-10-26-19(13)21(25)24-15-7-8-18(24)16-12-22-20(23-17(16)11-15)14-5-3-2-4-6-14/h2-6,9-10,12,15,18H,7-8,11H2,1H3/t15-,18+/m0/s1 |
| InChIKey | YEDUBQOAFXDFQH-MAUKXSAKSA-N |
| XLogP | 4.42 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |