C23H20FN3O — CID 110196680
2-(3-fluorophenyl)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone (PubChem CID 110196680) has the molecular formula C23H20FN3O and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
|---|---|
| PubChem CID | 110196680 |
| Molecular Formula | C23H20FN3O |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1[C@H]2CC[C@@H]1c1cnc(-c3ccccc3)nc1C2 |
| InChI | InChI=1S/C23H20FN3O/c24-17-8-4-5-15(11-17)12-22(28)27-18-9-10-21(27)19-14-25-23(26-20(19)13-18)16-6-2-1-3-7-16/h1-8,11,14,18,21H,9-10,12-13H2/t18-,21+/m0/s1 |
| InChIKey | MSUOEWRSVUTTLL-GHTZIAJQSA-N |
| XLogP | 4.11 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |