C22H24FN3O — CID 110196735
cyclohexyl-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 110196735) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is cyclohexyl-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | cyclohexyl-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 110196735 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | cyclohexyl-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C22H24FN3O/c23-16-8-6-14(7-9-16)21-24-13-18-19(25-21)12-17-10-11-20(18)26(17)22(27)15-4-2-1-3-5-15/h6-9,13,15,17,20H,1-5,10-12H2/t17-,20+/m0/s1 |
| InChIKey | ZLCNAHBASBTGNW-FXAWDEMLSA-N |
| XLogP | 4.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |