C18H20FN3O2S — CID 110196738
(1R,9S)-5-(4-fluorophenyl)-12-propylsulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 110196738) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is (1R,9S)-5-(4-fluorophenyl)-12-propylsulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9S)-5-(4-fluorophenyl)-12-propylsulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 110196738 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (1R,9S)-5-(4-fluorophenyl)-12-propylsulfonyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | CCCS(=O)(=O)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C18H20FN3O2S/c1-2-9-25(23,24)22-14-7-8-17(22)15-11-20-18(21-16(15)10-14)12-3-5-13(19)6-4-12/h3-6,11,14,17H,2,7-10H2,1H3/t14-,17+/m0/s1 |
| InChIKey | HFLGIWCAOJXHCM-WMLDXEAASA-N |
| XLogP | 3.08 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |