C20H22FN3O — CID 110196743
1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-3-methylbutan-1-one (PubChem CID 110196743) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 110196743 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C20H22FN3O/c1-12(2)9-19(25)24-15-7-8-18(24)16-11-22-20(23-17(16)10-15)13-3-5-14(21)6-4-13/h3-6,11-12,15,18H,7-10H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | JUDVZAOFPRULQO-MAUKXSAKSA-N |
| XLogP | 3.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |