C22H19FN4O — CID 110196760
[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 110196760) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 110196760 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2[C@H]3CC[C@@H]2c2cnc(-c4ccc(F)cc4)nc2C3)cn1 |
| InChI | InChI=1S/C22H19FN4O/c1-13-2-3-15(11-24-13)22(28)27-17-8-9-20(27)18-12-25-21(26-19(18)10-17)14-4-6-16(23)7-5-14/h2-7,11-12,17,20H,8-10H2,1H3/t17-,20+/m0/s1 |
| InChIKey | VMYOKLRMBVQMFE-FXAWDEMLSA-N |
| XLogP | 3.89 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |