C20H16FN3OS — CID 110196763
[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-thiophen-3-ylmethanone (PubChem CID 110196763) has the molecular formula C20H16FN3OS and a molecular weight of 365.43 g/mol. Its IUPAC name is [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-thiophen-3-ylmethanone.
| Compound Name | [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 110196763 |
| Molecular Formula | C20H16FN3OS |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C20H16FN3OS/c21-14-3-1-12(2-4-14)19-22-10-16-17(23-19)9-15-5-6-18(16)24(15)20(25)13-7-8-26-11-13/h1-4,7-8,10-11,15,18H,5-6,9H2/t15-,18+/m0/s1 |
| InChIKey | PYNGXOFZBRVXTO-MAUKXSAKSA-N |
| XLogP | 4.25 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |