C22H24FN3O — CID 110196777
2-cyclopentyl-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone (PubChem CID 110196777) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-cyclopentyl-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
|---|---|
| PubChem CID | 110196777 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-cyclopentyl-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
| SMILES | O=C(CC1CCCC1)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C22H24FN3O/c23-16-7-5-15(6-8-16)22-24-13-18-19(25-22)12-17-9-10-20(18)26(17)21(27)11-14-3-1-2-4-14/h5-8,13-14,17,20H,1-4,9-12H2/t17-,20+/m0/s1 |
| InChIKey | YYCYLQAZWHPIRZ-FXAWDEMLSA-N |
| XLogP | 4.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |