C20H16FN3O2 — CID 110196779
[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(furan-2-yl)methanone (PubChem CID 110196779) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(furan-2-yl)methanone.
| Compound Name | [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 110196779 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C20H16FN3O2/c21-13-5-3-12(4-6-13)19-22-11-15-16(23-19)10-14-7-8-17(15)24(14)20(25)18-2-1-9-26-18/h1-6,9,11,14,17H,7-8,10H2/t14-,17+/m0/s1 |
| InChIKey | ITRWIWMVTVYUFQ-WMLDXEAASA-N |
| XLogP | 3.78 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |