C22H19F4N5O — CID 110196787
1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 110196787) has the molecular formula C22H19F4N5O and a molecular weight of 445.42 g/mol. Its IUPAC name is 1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 110196787 |
| Molecular Formula | C22H19F4N5O |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1[C@H]2CC[C@@H]1c1cnc(-c3ccc(F)cc3)nc1C2 |
| InChI | InChI=1S/C22H19F4N5O/c1-12-8-19(22(24,25)26)29-30(12)11-20(32)31-15-6-7-18(31)16-10-27-21(28-17(16)9-15)13-2-4-14(23)5-3-13/h2-5,8,10,15,18H,6-7,9,11H2,1H3/t15-,18+/m0/s1 |
| InChIKey | AIDTUNILCSJUGW-MAUKXSAKSA-N |
| XLogP | 4.09 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |