C22H22FN5O — CID 110196792
2-(3,5-dimethylpyrazol-1-yl)-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone (PubChem CID 110196792) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
|---|---|
| PubChem CID | 110196792 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-1-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
| SMILES | Cc1cc(C)n(CC(=O)N2[C@H]3CC[C@@H]2c2cnc(-c4ccc(F)cc4)nc2C3)n1 |
| InChI | InChI=1S/C22H22FN5O/c1-13-9-14(2)27(26-13)12-21(29)28-17-7-8-20(28)18-11-24-22(25-19(18)10-17)15-3-5-16(23)6-4-15/h3-6,9,11,17,20H,7-8,10,12H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | AGTYTHVEJNIBIW-FXAWDEMLSA-N |
| XLogP | 3.38 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |