About morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone
morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone (PubChem CID 110196830) has the molecular formula C18H26N2O5S
and a molecular weight of 382.48 g/mol. Its IUPAC name is morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone |
| PubChem CID | 110196830 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone |
| SMILES | CCCS(=O)(=O)N1C[C@@H](Oc2ccccc2)C[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O5S/c1-2-12-26(22,23)20-14-16(25-15-6-4-3-5-7-15)13-17(20)18(21)19-8-10-24-11-9-19/h3-7,16-17H,2,8-14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | CEUDWISOPJUQFB-DLBZAZTESA-N |
| XLogP | 1.11 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone?
The IUPAC name of morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone (CID 110196830) is morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone.
What is the SMILES notation for morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone?
The canonical SMILES for morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone is CCCS(=O)(=O)N1C[C@@H](Oc2ccccc2)C[C@@H]1C(=O)N1CCOCC1.
What is the InChIKey of morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone?
The InChIKey is CEUDWISOPJUQFB-DLBZAZTESA-N. The full InChI is InChI=1S/C18H26N2O5S/c1-2-12-26(22,23)20-14-16(25-15-6-4-3-5-7-15)13-17(20)18(21)19-8-10-24-11-9-19/h3-7,16-17H,2,8-14H2,1H3/t16-,17+/m0/s1.
What are the key properties of morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone?
morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone has a molecular weight of 382.48 g/mol, XLogP of 1.11, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[(2R,4S)-4-phenoxy-1-propylsulfonylpyrrolidin-2-yl]methanone is sourced from PubChem (CID 110196830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).