C19H21N3O3 — CID 110196900
(2R,4S)-2-N-methyl-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 110196900) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2R,4S)-2-N-methyl-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-2-N-methyl-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110196900 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2R,4S)-2-N-methyl-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | CNC(=O)[C@H]1C[C@H](Oc2ccccc2)CN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-20-18(23)17-12-16(25-15-10-6-3-7-11-15)13-22(17)19(24)21-14-8-4-2-5-9-14/h2-11,16-17H,12-13H2,1H3,(H,20,23)(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | IFIIXMZHGBFBEQ-DLBZAZTESA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |