C21H25FN2O5S — CID 110196936
(2R,4S)-1-[(2-fluorophenyl)methylsulfonyl]-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 110196936) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is (2R,4S)-1-[(2-fluorophenyl)methylsulfonyl]-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-[(2-fluorophenyl)methylsulfonyl]-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110196936 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (2R,4S)-1-[(2-fluorophenyl)methylsulfonyl]-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2ccccc2)CN1S(=O)(=O)Cc1ccccc1F |
| InChI | InChI=1S/C21H25FN2O5S/c1-28-12-11-23-21(25)20-13-18(29-17-8-3-2-4-9-17)14-24(20)30(26,27)15-16-7-5-6-10-19(16)22/h2-10,18,20H,11-15H2,1H3,(H,23,25)/t18-,20+/m0/s1 |
| InChIKey | JCZPQOUOQZOOFT-AZUAARDMSA-N |
| XLogP | 1.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|