C21H25N3O4 — CID 110196940
(2R,4S)-2-N-(2-methoxyethyl)-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 110196940) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2R,4S)-2-N-(2-methoxyethyl)-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-2-N-(2-methoxyethyl)-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110196940 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2R,4S)-2-N-(2-methoxyethyl)-4-phenoxy-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2ccccc2)CN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-13-12-22-20(25)19-14-18(28-17-10-6-3-7-11-17)15-24(19)21(26)23-16-8-4-2-5-9-16/h2-11,18-19H,12-15H2,1H3,(H,22,25)(H,23,26)/t18-,19+/m0/s1 |
| InChIKey | KMMBNVRCTXOGBP-RBUKOAKNSA-N |
| XLogP | 2.50 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|