C21H26N4O4 — CID 110197053
(2R,4S)-2-N-(2-methoxyethyl)-1-N-(3-methylphenyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide (PubChem CID 110197053) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2R,4S)-2-N-(2-methoxyethyl)-1-N-(3-methylphenyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-2-N-(2-methoxyethyl)-1-N-(3-methylphenyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110197053 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2R,4S)-2-N-(2-methoxyethyl)-1-N-(3-methylphenyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2cccnc2)CN1C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C21H26N4O4/c1-15-5-3-6-16(11-15)24-21(27)25-14-18(29-17-7-4-8-22-13-17)12-19(25)20(26)23-9-10-28-2/h3-8,11,13,18-19H,9-10,12,14H2,1-2H3,(H,23,26)(H,24,27)/t18-,19+/m0/s1 |
| InChIKey | RFYMIOBCOKVDOK-RBUKOAKNSA-N |
| XLogP | 2.21 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|