C22H26N4O6 — CID 110197062
(2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide (PubChem CID 110197062) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is (2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110197062 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2cccnc2)CN1C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H26N4O6/c1-29-8-7-24-21(27)18-12-17(32-16-3-2-6-23-13-16)14-26(18)22(28)25-15-4-5-19-20(11-15)31-10-9-30-19/h2-6,11,13,17-18H,7-10,12,14H2,1H3,(H,24,27)(H,25,28)/t17-,18+/m0/s1 |
| InChIKey | FVBSRWZNUKTBGE-ZWKOTPCHSA-N |
| XLogP | 1.67 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|