About 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide
4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 110197132) has the molecular formula C12H21N3O3S
and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
| PubChem CID | 110197132 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | CCCNC(=O)N1CCC2(CC1)N(C)C(=O)CS2=O |
| InChI | InChI=1S/C12H21N3O3S/c1-3-6-13-11(17)15-7-4-12(5-8-15)14(2)10(16)9-19(12)18/h3-9H2,1-2H3,(H,13,17) |
| InChIKey | OHTIFSXDWZBLTI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide?
The IUPAC name of 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide (CID 110197132) is 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide.
What is the SMILES notation for 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide?
The canonical SMILES for 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide is CCCNC(=O)N1CCC2(CC1)N(C)C(=O)CS2=O.
What is the InChIKey of 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide?
The InChIKey is OHTIFSXDWZBLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3S/c1-3-6-13-11(17)15-7-4-12(5-8-15)14(2)10(16)9-19(12)18/h3-9H2,1-2H3,(H,13,17).
What are the key properties of 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide?
4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide has a molecular weight of 287.39 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dioxo-N-propyl-1λ4-thia-4,8-diazaspiro[4.5]decane-8-carboxamide is sourced from PubChem (CID 110197132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).