C11H14O3 — CID 11019727
4-(prop-2-enoxymethyl)-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 11019727) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(prop-2-enoxymethyl)-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | 4-(prop-2-enoxymethyl)-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 11019727 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-(prop-2-enoxymethyl)-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C=CCOCC1=C2COCC2CC1=O |
| InChI | InChI=1S/C11H14O3/c1-2-3-13-7-10-9-6-14-5-8(9)4-11(10)12/h2,8H,1,3-7H2 |
| InChIKey | OIDCUHIANKATKY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|