C22H33N3O5 — CID 110197462
(2S,4R)-4-hydroxy-N-(2-methoxyethyl)-1-[1-[2-(3-methylphenoxy)acetyl]piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 110197462) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-N-(2-methoxyethyl)-1-[1-[2-(3-methylphenoxy)acetyl]piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-hydroxy-N-(2-methoxyethyl)-1-[1-[2-(3-methylphenoxy)acetyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110197462 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (2S,4R)-4-hydroxy-N-(2-methoxyethyl)-1-[1-[2-(3-methylphenoxy)acetyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H](O)CN1C1CCN(C(=O)COc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H33N3O5/c1-16-4-3-5-19(12-16)30-15-21(27)24-9-6-17(7-10-24)25-14-18(26)13-20(25)22(28)23-8-11-29-2/h3-5,12,17-18,20,26H,6-11,13-15H2,1-2H3,(H,23,28)/t18-,20+/m1/s1 |
| InChIKey | DXJDRIZMMVZUQP-QUCCMNQESA-N |
| XLogP | 0.56 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|