C20H24N4O3S — CID 110197570
3,5-dimethyl-4-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylsulfonyl-1,2-oxazole (PubChem CID 110197570) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 3,5-dimethyl-4-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylsulfonyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylsulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 110197570 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3,5-dimethyl-4-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylsulfonyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC2(CC1)NCCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C20H24N4O3S/c1-13-18(14(2)27-23-13)28(25,26)24-11-8-20(9-12-24)19-16(7-10-21-20)15-5-3-4-6-17(15)22-19/h3-6,21-22H,7-12H2,1-2H3 |
| InChIKey | UQJBWKPSKPJEFZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |