C12H21NO — CID 11019767
(5R,6E,9R)-5-ethyl-9-methyl-2,3,4,5,8,9-hexahydro-1H-azecin-10-one (PubChem CID 11019767) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (5R,6E,9R)-5-ethyl-9-methyl-2,3,4,5,8,9-hexahydro-1H-azecin-10-one.
| Compound Name | (5R,6E,9R)-5-ethyl-9-methyl-2,3,4,5,8,9-hexahydro-1H-azecin-10-one |
|---|---|
| PubChem CID | 11019767 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (5R,6E,9R)-5-ethyl-9-methyl-2,3,4,5,8,9-hexahydro-1H-azecin-10-one |
| SMILES | CC[C@H]1/C=C/C[C@@H](C)C(=O)NCCC1 |
| InChI | InChI=1S/C12H21NO/c1-3-11-7-4-6-10(2)12(14)13-9-5-8-11/h4,7,10-11H,3,5-6,8-9H2,1-2H3,(H,13,14)/b7-4+/t10-,11+/m1/s1 |
| InChIKey | IKYVWNUUQLDMKZ-CEIHKIRRSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|