C9H12O5 — CID 11019875
(1R,2S,6S,8S,10R)-10-methoxy-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one (PubChem CID 11019875) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (1R,2S,6S,8S,10R)-10-methoxy-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one.
| Compound Name | (1R,2S,6S,8S,10R)-10-methoxy-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one |
|---|---|
| PubChem CID | 11019875 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1R,2S,6S,8S,10R)-10-methoxy-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-4-one |
| SMILES | CO[C@H]1C[C@H]2[C@@H](O1)O[C@H]1OC(=O)C[C@H]12 |
| InChI | InChI=1S/C9H12O5/c1-11-7-3-5-4-2-6(10)12-8(4)14-9(5)13-7/h4-5,7-9H,2-3H2,1H3/t4-,5+,7+,8+,9-/m0/s1 |
| InChIKey | GUZDDNOKQJEVEF-QCFOWSJWSA-N |
| XLogP | 0.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |