C17H25N3O4 — CID 110198842
(2S,4S)-N-(2-methoxyethyl)-1-(2-methylpropanoyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide (PubChem CID 110198842) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2S,4S)-N-(2-methoxyethyl)-1-(2-methylpropanoyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-(2-methoxyethyl)-1-(2-methylpropanoyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110198842 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (2S,4S)-N-(2-methoxyethyl)-1-(2-methylpropanoyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](Oc2cccnc2)CN1C(=O)C(C)C |
| InChI | InChI=1S/C17H25N3O4/c1-12(2)17(22)20-11-14(24-13-5-4-6-18-10-13)9-15(20)16(21)19-7-8-23-3/h4-6,10,12,14-15H,7-9,11H2,1-3H3,(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | ILDXIINYPUPUHK-GJZGRUSLSA-N |
| XLogP | 0.85 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|